C19H30F3N5O — CID 111290797
4-(3-methoxyphenyl)-N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide (PubChem CID 111290797) has the molecular formula C19H30F3N5O and a molecular weight of 401.48 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290797 |
| Molecular Formula | C19H30F3N5O |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C19H30F3N5O/c1-23-18(24-8-5-9-25(2)15-19(20,21)22)27-12-10-26(11-13-27)16-6-4-7-17(14-16)28-3/h4,6-7,14H,5,8-13,15H2,1-3H3,(H,23,24) |
| InChIKey | FRFFHBGMJROBQO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|