C15H25IN4O — CID 111290436
N-ethyl-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111290436) has the molecular formula C15H25IN4O and a molecular weight of 404.30 g/mol. Its IUPAC name is N-ethyl-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111290436 |
| Molecular Formula | C15H25IN4O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-ethyl-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\C)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C15H24N4O.HI/c1-4-17-15(16-2)19-10-8-18(9-11-19)13-6-5-7-14(12-13)20-3;/h5-7,12H,4,8-11H2,1-3H3,(H,16,17);1H |
| InChIKey | MDJUCAMFZLMICI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|