C18H25IN4OS — CID 111289996
4-(3-methoxyphenyl)-N'-methyl-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111289996) has the molecular formula C18H25IN4OS and a molecular weight of 472.40 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111289996 |
| Molecular Formula | C18H25IN4OS |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccs1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C18H24N4OS.HI/c1-19-18(20-14-17-7-4-12-24-17)22-10-8-21(9-11-22)15-5-3-6-16(13-15)23-2;/h3-7,12-13H,8-11,14H2,1-2H3,(H,19,20);1H |
| InChIKey | SZAJQRWGDGHPCU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|