C25H36IN5O2 — CID 111290172
4-(3-methoxyphenyl)-N'-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111290172) has the molecular formula C25H36IN5O2 and a molecular weight of 565.50 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111290172 |
| Molecular Formula | C25H36IN5O2 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(CN2CCOCC2)c1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C25H35N5O2.HI/c1-26-25(30-11-9-29(10-12-30)23-7-4-8-24(18-23)31-2)27-19-21-5-3-6-22(17-21)20-28-13-15-32-16-14-28;/h3-8,17-18H,9-16,19-20H2,1-2H3,(H,26,27);1H |
| InChIKey | UDJHTKFVDBAMID-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|