C23H31IN4O4 — CID 111290926
methyl 2-methoxy-5-[[[C-[4-(3-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111290926) has the molecular formula C23H31IN4O4 and a molecular weight of 554.43 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[C-[4-(3-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 2-methoxy-5-[[[C-[4-(3-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111290926 |
| Molecular Formula | C23H31IN4O4 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | methyl 2-methoxy-5-[[[C-[4-(3-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(C(=O)OC)c1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C23H30N4O4.HI/c1-24-23(25-16-17-8-9-21(30-3)20(14-17)22(28)31-4)27-12-10-26(11-13-27)18-6-5-7-19(15-18)29-2;/h5-9,14-15H,10-13,16H2,1-4H3,(H,24,25);1H |
| InChIKey | LKSNKALXQKCMAU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|