C17H25N7O — CID 111290289
4-(3-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111290289) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290289 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nncn1C)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C17H25N7O/c1-18-17(19-12-16-21-20-13-22(16)2)24-9-7-23(8-10-24)14-5-4-6-15(11-14)25-3/h4-6,11,13H,7-10,12H2,1-3H3,(H,18,19) |
| InChIKey | CDPVFIYVQNAHFZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|