C17H24N6O — CID 111732077
3-(4-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111732077) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(4-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111732077 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-N'-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nncn1C)N1CCC(c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C17H24N6O/c1-18-17(19-10-16-21-20-12-22(16)2)23-9-8-14(11-23)13-4-6-15(24-3)7-5-13/h4-7,12,14H,8-11H2,1-3H3,(H,18,19) |
| InChIKey | LSPHIJZCORKYKP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|