C22H28IN7O — CID 111290958
4-(3-methoxyphenyl)-N'-methyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111290958) has the molecular formula C22H28IN7O and a molecular weight of 533.42 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111290958 |
| Molecular Formula | C22H28IN7O |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nncn1-c1ccccc1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H27N7O.HI/c1-23-22(24-16-21-26-25-17-29(21)18-7-4-3-5-8-18)28-13-11-27(12-14-28)19-9-6-10-20(15-19)30-2;/h3-10,15,17H,11-14,16H2,1-2H3,(H,23,24);1H |
| InChIKey | ZCZWEZCWCXOBSR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|