C24H31N7O — CID 111290013
N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 111290013) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290013 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | COc1cccc(N2CCN(/C(=N/Cc3ccccc3)NCc3nnc(C)n3C)CC2)c1 |
| InChI | InChI=1S/C24H31N7O/c1-19-27-28-23(29(19)2)18-26-24(25-17-20-8-5-4-6-9-20)31-14-12-30(13-15-31)21-10-7-11-22(16-21)32-3/h4-11,16H,12-15,17-18H2,1-3H3,(H,25,26) |
| InChIKey | JEKLRHLCUIKUQB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|