C20H28F3N7 — CID 109376451
N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376451) has the molecular formula C20H28F3N7 and a molecular weight of 423.49 g/mol. Its IUPAC name is N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376451 |
| Molecular Formula | C20H28F3N7 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | N'-benzyl-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccccc2)N2CCN(C(C)C(F)(F)F)CC2)n1C |
| InChI | InChI=1S/C20H28F3N7/c1-15(20(21,22)23)29-9-11-30(12-10-29)19(24-13-17-7-5-4-6-8-17)25-14-18-27-26-16(2)28(18)3/h4-8,15H,9-14H2,1-3H3,(H,24,25) |
| InChIKey | NUSCNDYDCFTRDI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|