C23H30N6O2 — CID 111679766
2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-methoxyphenoxy)propyl]guanidine (PubChem CID 111679766) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-methoxyphenoxy)propyl]guanidine.
| Compound Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-methoxyphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111679766 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-methoxyphenoxy)propyl]guanidine |
| SMILES | COc1cccc(OC(C)CN/C(=N/Cc2ccccc2)NCc2nnc(C)n2C)c1 |
| InChI | InChI=1S/C23H30N6O2/c1-17(31-21-12-8-11-20(13-21)30-4)14-24-23(25-15-19-9-6-5-7-10-19)26-16-22-28-27-18(2)29(22)3/h5-13,17H,14-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | OWSYYVPZRVVWIP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|