C21H26FIN6O — CID 111770108
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111770108) has the molecular formula C21H26FIN6O and a molecular weight of 524.38 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111770108 |
| Molecular Formula | C21H26FIN6O |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-[(4-methoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\NCc2ccccc2F)NCc2nnc(C)n2C)cc1.I |
| InChI | InChI=1S/C21H25FN6O.HI/c1-15-26-27-20(28(15)2)14-25-21(24-13-17-6-4-5-7-19(17)22)23-12-16-8-10-18(29-3)11-9-16;/h4-11H,12-14H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | QGBTXQRMDAQGCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|