C20H32IN7O2 — CID 111843153
N-tert-butyl-2-[[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111843153) has the molecular formula C20H32IN7O2 and a molecular weight of 529.43 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111843153 |
| Molecular Formula | C20H32IN7O2 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N-tert-butyl-2-[[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)NC(C)(C)C)NCc2nnc(C)n2C)cc1.I |
| InChI | InChI=1S/C20H31N7O2.HI/c1-14-25-26-17(27(14)5)12-22-19(23-13-18(28)24-20(2,3)4)21-11-15-7-9-16(29-6)10-8-15;/h7-10H,11-13H2,1-6H3,(H,24,28)(H2,21,22,23);1H |
| InChIKey | KBZSAPLWNYWGPH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|