C19H32IN5O3 — CID 111842493
N-tert-butyl-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111842493) has the molecular formula C19H32IN5O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111842493 |
| Molecular Formula | C19H32IN5O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(dimethylamino)-2-oxoethyl]-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(/NCC(=O)NC(C)(C)C)NCC(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C19H31N5O3.HI/c1-19(2,3)23-16(25)12-21-18(22-13-17(26)24(4)5)20-11-14-7-9-15(27-6)10-8-14;/h7-10H,11-13H2,1-6H3,(H,23,25)(H2,20,21,22);1H |
| InChIKey | KKQIZQSZCHZFAU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|