C20H32N4O2 — CID 111290235
N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 111290235) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290235 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(O)CCCC1)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C20H32N4O2/c1-3-21-19(22-16-20(25)9-4-5-10-20)24-13-11-23(12-14-24)17-7-6-8-18(15-17)26-2/h6-8,15,25H,3-5,9-14,16H2,1-2H3,(H,21,22) |
| InChIKey | JKPKCWZWZQRAFC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|