C22H37N5O2 — CID 111290767
N-ethyl-4-(3-methoxyphenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide (PubChem CID 111290767) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-ethyl-4-(3-methoxyphenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(3-methoxyphenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290767 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | N-ethyl-4-(3-methoxyphenyl)-N'-(4-morpholin-4-ylbutyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCOCC1)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C22H37N5O2/c1-3-23-22(24-9-4-5-10-25-15-17-29-18-16-25)27-13-11-26(12-14-27)20-7-6-8-21(19-20)28-2/h6-8,19H,3-5,9-18H2,1-2H3,(H,23,24) |
| InChIKey | FPAWJLZZOWMWCS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|