C22H37IN4O3 — CID 111290122
N-ethyl-4-(3-methoxyphenyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111290122) has the molecular formula C22H37IN4O3 and a molecular weight of 532.47 g/mol. Its IUPAC name is N-ethyl-4-(3-methoxyphenyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(3-methoxyphenyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111290122 |
| Molecular Formula | C22H37IN4O3 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | N-ethyl-4-(3-methoxyphenyl)-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H36N4O3.HI/c1-3-23-22(24-10-6-15-28-18-21-9-5-16-29-21)26-13-11-25(12-14-26)19-7-4-8-20(17-19)27-2;/h4,7-8,17,21H,3,5-6,9-16,18H2,1-2H3,(H,23,24);1H |
| InChIKey | ZCOJJKJERAHUCJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|