C24H40N4O4 — CID 111303041
4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide (PubChem CID 111303041) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111303041 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCOCC1CCCO1)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C24H40N4O4/c1-4-25-24(26-10-6-15-31-19-22-7-5-16-32-22)28-13-11-27(12-14-28)18-20-17-21(29-2)8-9-23(20)30-3/h8-9,17,22H,4-7,10-16,18-19H2,1-3H3,(H,25,26) |
| InChIKey | SSTVXMOBLFRFEY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|