C22H35IN6O3 — CID 111303030
4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111303030) has the molecular formula C22H35IN6O3 and a molecular weight of 558.47 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111303030 |
| Molecular Formula | C22H35IN6O3 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N'-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc(C)no1)N1CCN(Cc2cc(OC)ccc2OC)CC1.I |
| InChI | InChI=1S/C22H34N6O3.HI/c1-5-23-22(24-10-6-7-21-25-17(2)26-31-21)28-13-11-27(12-14-28)16-18-15-19(29-3)8-9-20(18)30-4;/h8-9,15H,5-7,10-14,16H2,1-4H3,(H,23,24);1H |
| InChIKey | XXPUCUOLYQXTAQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|