C21H32IN5O2 — CID 110955613
N-ethyl-N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110955613) has the molecular formula C21H32IN5O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is N-ethyl-N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110955613 |
| Molecular Formula | C21H32IN5O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-ethyl-N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCCc1nc(-c2ccc(OC)cc2)no1)N1CCCC1.I |
| InChI | InChI=1S/C21H31N5O2.HI/c1-3-22-21(26-15-7-8-16-26)23-14-6-4-5-9-19-24-20(25-28-19)17-10-12-18(27-2)13-11-17;/h10-13H,3-9,14-16H2,1-2H3,(H,22,23);1H |
| InChIKey | PLYPFOZHFLBIKY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|