C20H30IN5O2 — CID 111036191
N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111036191) has the molecular formula C20H30IN5O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111036191 |
| Molecular Formula | C20H30IN5O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N'-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | COc1ccc(-c2noc(CCCCC/N=C(\N)N3CCCCC3)n2)cc1.I |
| InChI | InChI=1S/C20H29N5O2.HI/c1-26-17-11-9-16(10-12-17)19-23-18(27-24-19)8-4-2-5-13-22-20(21)25-14-6-3-7-15-25;/h9-12H,2-8,13-15H2,1H3,(H2,21,22);1H |
| InChIKey | IISNOHQBHASAPP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|