C22H36IN5O2S — CID 111626413
1-ethyl-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111626413) has the molecular formula C22H36IN5O2S and a molecular weight of 561.53 g/mol. Its IUPAC name is 1-ethyl-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111626413 |
| Molecular Formula | C22H36IN5O2S |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 1-ethyl-2-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCCc1nc(-c2ccc(OC)cc2)no1)NCCCCSC.I |
| InChI | InChI=1S/C22H35N5O2S.HI/c1-4-23-22(25-16-8-9-17-30-3)24-15-7-5-6-10-20-26-21(27-29-20)18-11-13-19(28-2)14-12-18;/h11-14H,4-10,15-17H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | LNLDIOLUUMLHKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|