C22H35IN6O3 — CID 111036173
1-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111036173) has the molecular formula C22H35IN6O3 and a molecular weight of 558.47 g/mol. Its IUPAC name is 1-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111036173 |
| Molecular Formula | C22H35IN6O3 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 1-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(-c2noc(CCCCCN/C(N)=N/CCCN3CCOCC3)n2)cc1.I |
| InChI | InChI=1S/C22H34N6O3.HI/c1-29-19-9-7-18(8-10-19)21-26-20(31-27-21)6-3-2-4-11-24-22(23)25-12-5-13-28-14-16-30-17-15-28;/h7-10H,2-6,11-17H2,1H3,(H3,23,24,25);1H |
| InChIKey | QWKXMGDOUMBYFC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|