C20H28N4O4 — CID 55742496
3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-morpholin-4-ylbutyl)propanamide (PubChem CID 55742496) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-morpholin-4-ylbutyl)propanamide.
| Compound Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-morpholin-4-ylbutyl)propanamide |
|---|---|
| PubChem CID | 55742496 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(4-morpholin-4-ylbutyl)propanamide |
| SMILES | COc1ccc(-c2noc(CCC(=O)NCCCCN3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H28N4O4/c1-26-17-6-4-16(5-7-17)20-22-19(28-23-20)9-8-18(25)21-10-2-3-11-24-12-14-27-15-13-24/h4-7H,2-3,8-15H2,1H3,(H,21,25) |
| InChIKey | DMNFCNIUDUSTJX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|