C23H34N4O3 — CID 47889008
4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide (PubChem CID 47889008) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide.
| Compound Name | 4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 47889008 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)butyl]butanamide |
| SMILES | COc1ccc(-c2noc(CCCC(=O)NCCCCN3CCC(C)CC3)n2)cc1 |
| InChI | InChI=1S/C23H34N4O3/c1-18-12-16-27(17-13-18)15-4-3-14-24-21(28)6-5-7-22-25-23(26-30-22)19-8-10-20(29-2)11-9-19/h8-11,18H,3-7,12-17H2,1-2H3,(H,24,28) |
| InChIKey | UQNKWZAYJKQEPK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|