C22H24ClN3O3 — CID 55919632
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methoxyphenyl)propyl]butanamide (PubChem CID 55919632) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methoxyphenyl)propyl]butanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methoxyphenyl)propyl]butanamide |
|---|---|
| PubChem CID | 55919632 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[3-(4-methoxyphenyl)propyl]butanamide |
| SMILES | COc1ccc(CCCNC(=O)CCCc2nc(-c3ccc(Cl)cc3)no2)cc1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-28-19-13-7-16(8-14-19)4-3-15-24-20(27)5-2-6-21-25-22(26-29-21)17-9-11-18(23)12-10-17/h7-14H,2-6,15H2,1H3,(H,24,27) |
| InChIKey | IUIYRYDRBYCBCY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|