C20H21Cl2N5O3 — CID 55723238
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide (PubChem CID 55723238) has the molecular formula C20H21Cl2N5O3 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
|---|---|
| PubChem CID | 55723238 |
| Molecular Formula | C20H21Cl2N5O3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
| SMILES | COc1ccc(-c2noc(CCCC(=O)NCCNc3ncc(Cl)cc3Cl)n2)cc1 |
| InChI | InChI=1S/C20H21Cl2N5O3/c1-29-15-7-5-13(6-8-15)19-26-18(30-27-19)4-2-3-17(28)23-9-10-24-20-16(22)11-14(21)12-25-20/h5-8,11-12H,2-4,9-10H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | OWRGPFFMDRWYER-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|