C17H19Cl2N3O3 — CID 78878862
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(2,5-dimethoxyphenyl)acetamide (PubChem CID 78878862) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 78878862 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(CC(=O)NCCNc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H19Cl2N3O3/c1-24-13-3-4-15(25-2)11(7-13)8-16(23)20-5-6-21-17-14(19)9-12(18)10-22-17/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | RRIMDXFWVLQMIL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|