C21H20Cl2N4O4S — CID 55722270
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 55722270) has the molecular formula C21H20Cl2N4O4S and a molecular weight of 495.39 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55722270 |
| Molecular Formula | C21H20Cl2N4O4S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NCCNc3ncc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C21H20Cl2N4O4S/c1-31-17-7-5-16(6-8-17)27-32(29,30)18-4-2-3-14(11-18)21(28)25-10-9-24-20-19(23)12-15(22)13-26-20/h2-8,11-13,27H,9-10H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | PVAWKDKSBHNFQB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|