C15H21Cl2N3O2 — CID 87018159
2-cyclohexyloxy-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 87018159) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-cyclohexyloxy-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 87018159 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-cyclohexyloxy-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | O=C(COC1CCCCC1)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O2/c16-11-8-13(17)15(20-9-11)19-7-6-18-14(21)10-22-12-4-2-1-3-5-12/h8-9,12H,1-7,10H2,(H,18,21)(H,19,20) |
| InChIKey | NDOUFCUSZIRDGF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|