C17H24Cl2N4O3 — CID 60554807
tert-butyl 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 60554807) has the molecular formula C17H24Cl2N4O3 and a molecular weight of 403.31 g/mol. Its IUPAC name is tert-butyl 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 60554807 |
| Molecular Formula | C17H24Cl2N4O3 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | tert-butyl 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C17H24Cl2N4O3/c1-17(2,3)26-16(25)23-8-4-5-13(23)15(24)21-7-6-20-14-12(19)9-11(18)10-22-14/h9-10,13H,4-8H2,1-3H3,(H,20,22)(H,21,24) |
| InChIKey | AVZHCDCQAMLFGD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|