C13H18Cl2N4O — CID 136560466
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethylazetidine-2-carboxamide (PubChem CID 136560466) has the molecular formula C13H18Cl2N4O and a molecular weight of 317.22 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethylazetidine-2-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 136560466 |
| Molecular Formula | C13H18Cl2N4O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethylazetidine-2-carboxamide |
| SMILES | CCN1CCC1C(=O)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N4O/c1-2-19-6-3-11(19)13(20)17-5-4-16-12-10(15)7-9(14)8-18-12/h7-8,11H,2-6H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | JZISMQLAVLVLKD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|