C17H15Cl2N3O3 — CID 94130035
(3S)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 94130035) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is (3S)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | (3S)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 94130035 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (3S)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | O=C1O[C@H](C(=O)NCCNc2ncc(Cl)cc2Cl)Cc2ccccc21 |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-11-8-13(19)15(22-9-11)20-5-6-21-16(23)14-7-10-3-1-2-4-12(10)17(24)25-14/h1-4,8-9,14H,5-7H2,(H,20,22)(H,21,23)/t14-/m0/s1 |
| InChIKey | BETMPLXLZZSQNJ-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|