C17H16Cl3N3O — CID 55723456
2-(2-chlorophenyl)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]cyclopropane-1-carboxamide (PubChem CID 55723456) has the molecular formula C17H16Cl3N3O and a molecular weight of 384.69 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55723456 |
| Molecular Formula | C17H16Cl3N3O |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCNc1ncc(Cl)cc1Cl)C1CC1c1ccccc1Cl |
| InChI | InChI=1S/C17H16Cl3N3O/c18-10-7-15(20)16(23-9-10)21-5-6-22-17(24)13-8-12(13)11-3-1-2-4-14(11)19/h1-4,7,9,12-13H,5-6,8H2,(H,21,23)(H,22,24) |
| InChIKey | VAQVJHIRZHFYGS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|