C19H19ClN2O3 — CID 52531252
N-[2-[[(1S,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]ethyl]-4-hydroxybenzamide (PubChem CID 52531252) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[2-[[(1S,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]ethyl]-4-hydroxybenzamide.
| Compound Name | N-[2-[[(1S,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]ethyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 52531252 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[2-[[(1S,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]amino]ethyl]-4-hydroxybenzamide |
| SMILES | O=C(NCCNC(=O)[C@H]1C[C@@H]1c1ccccc1Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H19ClN2O3/c20-17-4-2-1-3-14(17)15-11-16(15)19(25)22-10-9-21-18(24)12-5-7-13(23)8-6-12/h1-8,15-16,23H,9-11H2,(H,21,24)(H,22,25)/t15-,16+/m1/s1 |
| InChIKey | XHXVHXJGMVHXFX-CVEARBPZSA-N |
| XLogP | 2.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|