C25H23ClN2O2 — CID 55898897
N-[3-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]-4-methylbenzamide (PubChem CID 55898897) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is N-[3-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55898897 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[3-[[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(CNC(=O)C3CC3c3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-16-9-11-18(12-10-16)24(29)28-19-6-4-5-17(13-19)15-27-25(30)22-14-21(22)20-7-2-3-8-23(20)26/h2-13,21-22H,14-15H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | SLHFXONZYJRYKH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |