C21H17Cl2N3O2 — CID 167909819
2,5-dichloro-N-[[3-[(4-methylbenzoyl)amino]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 167909819) has the molecular formula C21H17Cl2N3O2 and a molecular weight of 414.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[[3-[(4-methylbenzoyl)amino]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[[3-[(4-methylbenzoyl)amino]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167909819 |
| Molecular Formula | C21H17Cl2N3O2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2,5-dichloro-N-[[3-[(4-methylbenzoyl)amino]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(CNC(=O)c3cc(Cl)ncc3Cl)c2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O2/c1-13-5-7-15(8-6-13)20(27)26-16-4-2-3-14(9-16)11-25-21(28)17-10-19(23)24-12-18(17)22/h2-10,12H,11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | WVNKJASOPVKQIO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|