C21H15Cl2FN2O2 — CID 55893391
2,3-dichloro-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide (PubChem CID 55893391) has the molecular formula C21H15Cl2FN2O2 and a molecular weight of 417.27 g/mol. Its IUPAC name is 2,3-dichloro-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide.
| Compound Name | 2,3-dichloro-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55893391 |
| Molecular Formula | C21H15Cl2FN2O2 |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2,3-dichloro-N-[[3-[(4-fluorobenzoyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(Nc1cccc(CNC(=O)c2cccc(Cl)c2Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15Cl2FN2O2/c22-18-6-2-5-17(19(18)23)21(28)25-12-13-3-1-4-16(11-13)26-20(27)14-7-9-15(24)10-8-14/h1-11H,12H2,(H,25,28)(H,26,27) |
| InChIKey | GZEGJWWABVHCRG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |