C23H21ClFN3O4S — CID 55947108
N-[3-[[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]methyl]phenyl]-4-fluorobenzamide (PubChem CID 55947108) has the molecular formula C23H21ClFN3O4S and a molecular weight of 489.96 g/mol. Its IUPAC name is N-[3-[[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]methyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]methyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55947108 |
| Molecular Formula | C23H21ClFN3O4S |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-[3-[[3-[(2-chlorophenyl)sulfonylamino]propanoylamino]methyl]phenyl]-4-fluorobenzamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1Cl)NCc1cccc(NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H21ClFN3O4S/c24-20-6-1-2-7-21(20)33(31,32)27-13-12-22(29)26-15-16-4-3-5-19(14-16)28-23(30)17-8-10-18(25)11-9-17/h1-11,14,27H,12-13,15H2,(H,26,29)(H,28,30) |
| InChIKey | HWGMJVMFIGAYRL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |