C13H10Cl2N4O2 — CID 114917801
N-[3-(carbamoylamino)phenyl]-2,5-dichloropyridine-4-carboxamide (PubChem CID 114917801) has the molecular formula C13H10Cl2N4O2 and a molecular weight of 325.16 g/mol. Its IUPAC name is N-[3-(carbamoylamino)phenyl]-2,5-dichloropyridine-4-carboxamide.
| Compound Name | N-[3-(carbamoylamino)phenyl]-2,5-dichloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917801 |
| Molecular Formula | C13H10Cl2N4O2 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-[3-(carbamoylamino)phenyl]-2,5-dichloropyridine-4-carboxamide |
| SMILES | NC(=O)Nc1cccc(NC(=O)c2cc(Cl)ncc2Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N4O2/c14-10-6-17-11(15)5-9(10)12(20)18-7-2-1-3-8(4-7)19-13(16)21/h1-6H,(H,18,20)(H3,16,19,21) |
| InChIKey | NUGBMLWQVIHWES-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|