C11H7Cl2N3O2S — CID 114917686
N-(3-carbamoylthiophen-2-yl)-2,5-dichloropyridine-4-carboxamide (PubChem CID 114917686) has the molecular formula C11H7Cl2N3O2S and a molecular weight of 316.17 g/mol. Its IUPAC name is N-(3-carbamoylthiophen-2-yl)-2,5-dichloropyridine-4-carboxamide.
| Compound Name | N-(3-carbamoylthiophen-2-yl)-2,5-dichloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917686 |
| Molecular Formula | C11H7Cl2N3O2S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | N-(3-carbamoylthiophen-2-yl)-2,5-dichloropyridine-4-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C11H7Cl2N3O2S/c12-7-4-15-8(13)3-6(7)10(18)16-11-5(9(14)17)1-2-19-11/h1-4H,(H2,14,17)(H,16,18) |
| InChIKey | IJOXSXKEKNPCCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|