C12H8Cl2N2O2S — CID 2117879
2-[(2,3-dichlorobenzoyl)amino]thiophene-3-carboxamide (PubChem CID 2117879) has the molecular formula C12H8Cl2N2O2S and a molecular weight of 315.18 g/mol. Its IUPAC name is 2-[(2,3-dichlorobenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(2,3-dichlorobenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2117879 |
| Molecular Formula | C12H8Cl2N2O2S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2-[(2,3-dichlorobenzoyl)amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl2N2O2S/c13-8-3-1-2-6(9(8)14)11(18)16-12-7(10(15)17)4-5-19-12/h1-5H,(H2,15,17)(H,16,18) |
| InChIKey | HHZQIAXGLBWXCT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |