C15H13ClN2O4S — CID 40820884
[(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate (PubChem CID 40820884) has the molecular formula C15H13ClN2O4S and a molecular weight of 352.80 g/mol. Its IUPAC name is [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate.
| Compound Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 40820884 |
| Molecular Formula | C15H13ClN2O4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-chlorobenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1Cl)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H13ClN2O4S/c1-8(22-15(21)9-4-2-3-5-11(9)16)13(20)18-14-10(12(17)19)6-7-23-14/h2-8H,1H3,(H2,17,19)(H,18,20)/t8-/m0/s1 |
| InChIKey | LSPCDTIKSNNLII-QMMMGPOBSA-N |
| XLogP | 2.68 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |