C15H14FN3O4S — CID 17392567
[1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate (PubChem CID 17392567) has the molecular formula C15H14FN3O4S and a molecular weight of 351.36 g/mol. Its IUPAC name is [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate.
| Compound Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 17392567 |
| Molecular Formula | C15H14FN3O4S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate |
| SMILES | CC(OC(=O)c1ccc(F)cc1N)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H14FN3O4S/c1-7(13(21)19-14-10(12(18)20)4-5-24-14)23-15(22)9-3-2-8(16)6-11(9)17/h2-7H,17H2,1H3,(H2,18,20)(H,19,21) |
| InChIKey | XCCLLGMOHLDOML-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|