C17H17FN2O4 — CID 41095814
[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate (PubChem CID 41095814) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate.
| Compound Name | [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 41095814 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate |
| SMILES | COc1ccc(NC(=O)[C@@H](C)OC(=O)c2ccc(F)cc2N)cc1 |
| InChI | InChI=1S/C17H17FN2O4/c1-10(16(21)20-12-4-6-13(23-2)7-5-12)24-17(22)14-8-3-11(18)9-15(14)19/h3-10H,19H2,1-2H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | WYPVWAMPSHVODT-SNVBAGLBSA-N |
| XLogP | 2.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|