C16H16N2O5S — CID 8550118
[(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate (PubChem CID 8550118) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 8550118 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)Nc2sccc2C(N)=O)c(O)c1 |
| InChI | InChI=1S/C16H16N2O5S/c1-8-3-4-10(12(19)7-8)16(22)23-9(2)14(21)18-15-11(13(17)20)5-6-24-15/h3-7,9,19H,1-2H3,(H2,17,20)(H,18,21)/t9-/m0/s1 |
| InChIKey | STCUQXXKZZBRBH-VIFPVBQESA-N |
| XLogP | 2.05 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |