C19H16N2O4S — CID 41090633
[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] naphthalene-1-carboxylate (PubChem CID 41090633) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] naphthalene-1-carboxylate.
| Compound Name | [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 41090633 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] naphthalene-1-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cccc2ccccc12)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C19H16N2O4S/c1-11(17(23)21-18-15(16(20)22)9-10-26-18)25-19(24)14-8-4-6-12-5-2-3-7-13(12)14/h2-11H,1H3,(H2,20,22)(H,21,23)/t11-/m1/s1 |
| InChIKey | MYEDXUMWAYQPTR-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |