C18H17N3O4S — CID 47011526
[1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate (PubChem CID 47011526) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 47011526 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(1H-indol-3-yl)acetate |
| SMILES | CC(OC(=O)Cc1c[nH]c2ccccc12)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C18H17N3O4S/c1-10(17(24)21-18-13(16(19)23)6-7-26-18)25-15(22)8-11-9-20-14-5-3-2-4-12(11)14/h2-7,9-10,20H,8H2,1H3,(H2,19,23)(H,21,24) |
| InChIKey | NDJAXNDFDJJFIL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |