C15H14N2O4S — CID 25387908
[(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] benzoate (PubChem CID 25387908) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] benzoate.
| Compound Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] benzoate |
|---|---|
| PubChem CID | 25387908 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H14N2O4S/c1-9(21-15(20)10-5-3-2-4-6-10)13(19)17-14-11(12(16)18)7-8-22-14/h2-9H,1H3,(H2,16,18)(H,17,19)/t9-/m0/s1 |
| InChIKey | YXQKHEDOZZKRRF-VIFPVBQESA-N |
| XLogP | 2.03 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |