C16H16N2O5S — CID 41259825
[(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-methoxybenzoate (PubChem CID 41259825) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-methoxybenzoate.
| Compound Name | [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 41259825 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(2R)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)O[C@H](C)C(=O)Nc2sccc2C(N)=O)c1 |
| InChI | InChI=1S/C16H16N2O5S/c1-9(14(20)18-15-12(13(17)19)6-7-24-15)23-16(21)10-4-3-5-11(8-10)22-2/h3-9H,1-2H3,(H2,17,19)(H,18,20)/t9-/m1/s1 |
| InChIKey | AFGAJZHWRGKYQH-SECBINFHSA-N |
| XLogP | 2.04 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |